Difference between revisions of "CPD-7010"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) * inchi-key: ** pu...") |
(Created page with "Category:metabolite == Metabolite CPD-7010 == * smiles: ** c(o)c3(oc(oc2(c(o)c(o)c(oc1(=cc=c(c=c1)cc(c([a [glycogenin]])=o)n[a [glycogenin]]))oc(co)2))c(o)c(o)c(o)3) * com...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7010 == |
| + | * smiles: | ||
| + | ** c(o)c3(oc(oc2(c(o)c(o)c(oc1(=cc=c(c=c1)cc(c([a [glycogenin]])=o)n[a [glycogenin]]))oc(co)2))c(o)c(o)c(o)3) | ||
* common-name: | * common-name: | ||
| − | ** & | + | ** (1,4-α-d-glucosyl)n-glucosyl glucogenin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7667]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=(1,4-α-d-glucosyl)n-glucosyl glucogenin}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7010
- smiles:
- c(o)c3(oc(oc2(c(o)c(o)c(oc1(=cc=c(c=c1)cc(c([a [glycogenin]])=o)n[a [glycogenin]]))oc(co)2))c(o)c(o)c(o)3)
- common-name:
- (1,4-α-d-glucosyl)n-glucosyl glucogenin
