Difference between revisions of "CPD-11715"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7100 == * common-name: ** (2s)-2-isopropyl-3-oxosuccinate * smiles: ** cc(c(c(=o)[o-])c(=o)c(=o)[o-])c * inchi-key: ** hiizagqwabamrr...") |
(Created page with "Category:metabolite == Metabolite CPD-11715 == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) * inchi-key: ** utyvdvlmyqplqb-uhfffaoys...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11715 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phenylacetylglycine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** utyvdvlmyqplqb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 192.194 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10821]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phenylacetylglycine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=utyvdvlmyqplqb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=192.194}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11715
- common-name:
- phenylacetylglycine
- smiles:
- c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1)
- inchi-key:
- utyvdvlmyqplqb-uhfffaoysa-m
- molecular-weight:
- 192.194
