Difference between revisions of "BILIVERDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HG+2 == * common-name: ** hg2+ * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffaoysa-n * molecular-weight: ** 200.59 == Reaction(...")
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HG+2 ==
+
== Metabolite BILIVERDINE ==
 
* common-name:
 
* common-name:
** hg2+
+
** biliverdin-ix-α
 
* smiles:
 
* smiles:
** [hg++]
+
** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
 
* inchi-key:
 
* inchi-key:
** bqpiggfysbelgy-uhfffaoysa-n
+
** qbuvfdktzjnupp-msgwkzgbsa-l
 
* molecular-weight:
 
* molecular-weight:
** 200.59
+
** 580.639
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MERCURY-II-REDUCTASE-RXN]]
+
* [[1.3.7.2-RXN]]
 +
* [[1.3.7.4-RXN]]
 +
* [[R05818]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 +
* [[R05818]]
 +
* [[RXN-17523]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hg2+}}
+
{{#set: common-name=biliverdin-ix-α}}
{{#set: inchi-key=inchikey=bqpiggfysbelgy-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}}
{{#set: molecular-weight=200.59}}
+
{{#set: molecular-weight=580.639}}

Latest revision as of 11:12, 18 March 2021

Metabolite BILIVERDINE

  • common-name:
    • biliverdin-ix-α
  • smiles:
    • c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
  • inchi-key:
    • qbuvfdktzjnupp-msgwkzgbsa-l
  • molecular-weight:
    • 580.639

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality