Difference between revisions of "MRNA-Adenines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...")
(Created page with "Category:metabolite == Metabolite mRNA-Adenines == * common-name: ** an adenine in mrna == Reaction(s) known to consume the compound == * RXN-17811 == Reaction(s) know...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHINE ==
+
== Metabolite mRNA-Adenines ==
 
* common-name:
 
* common-name:
** xanthine
+
** an adenine in mrna
* smiles:
 
** c12(nc(=o)nc(c=1n=cn2)=o)
 
* inchi-key:
 
** lrfvtywoqmyalw-uhfffaoysa-n
 
* molecular-weight:
 
** 152.112
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-901]]
+
* [[RXN-17811]]
* [[XANTHINE-OXIDASE-RXN]]
 
* [[XNDH]]
 
* [[XPPRT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GUANINE-DEAMINASE-RXN]]
+
* [[RXN-17811]]
* [[RXN-7682]]
 
* [[RXN0-363]]
 
* [[RXN0-901]]
 
* [[XANDH]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
* [[XPPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthine}}
+
{{#set: common-name=an adenine in mrna}}
{{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}}
 
{{#set: molecular-weight=152.112}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite mRNA-Adenines

  • common-name:
    • an adenine in mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality