Difference between revisions of "CPD-18761"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-171 == * common-name: ** a dolichyl β-d-mannosyl phosphate == Reaction(s) known to consume the compound == * 2.4.1.109-RXN *...") |
(Created page with "Category:metabolite == Metabolite CPD-18761 == * common-name: ** coniferyl alcohol radical * smiles: ** coc1(=cc(=ccco)c=cc(=o)1) * inchi-key: ** orajwsykrgvtdp-uhfffaoysa...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-18761 == |
* common-name: | * common-name: | ||
| − | ** | + | ** coniferyl alcohol radical |
| + | * smiles: | ||
| + | ** coc1(=cc(=ccco)c=cc(=o)1) | ||
| + | * inchi-key: | ||
| + | ** orajwsykrgvtdp-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 179.195 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17351]] |
| + | * [[RXN-17352]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coniferyl alcohol radical}} |
| + | {{#set: inchi-key=inchikey=orajwsykrgvtdp-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=179.195}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-18761
- common-name:
- coniferyl alcohol radical
- smiles:
- coc1(=cc(=ccco)c=cc(=o)1)
- inchi-key:
- orajwsykrgvtdp-uhfffaoysa-n
- molecular-weight:
- 179.195
