Difference between revisions of "Glucuronosylated-Glucuronoside-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...") |
(Created page with "Category:metabolite == Metabolite Glucuronosylated-Glucuronoside-Acceptors == * common-name: ** a glucuronated glucosyluronate acceptor == Reaction(s) known to consume the...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glucuronosylated-Glucuronoside-Acceptors == |
* common-name: | * common-name: | ||
| − | ** | + | ** a glucuronated glucosyluronate acceptor |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[UDP-GLUCURONOSYLTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a glucuronated glucosyluronate acceptor}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Glucuronosylated-Glucuronoside-Acceptors
- common-name:
- a glucuronated glucosyluronate acceptor
