Difference between revisions of "CPD-567"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15837 == * common-name: ** β-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=cc=2c)o)c)))c)c)c * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-567 == * common-name: ** n6-acetyl-l-lysine * smiles: ** cc(nccccc([n+])c(=o)[o-])=o * inchi-key: ** dterqygmudwyaz-zetcqymhsa-n * mo...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-567 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-acetyl-l-lysine |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(nccccc([n+])c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dterqygmudwyaz-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 188.226 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-acetyl-l-lysine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dterqygmudwyaz-zetcqymhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=188.226}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-567
- common-name:
- n6-acetyl-l-lysine
- smiles:
- cc(nccccc([n+])c(=o)[o-])=o
- inchi-key:
- dterqygmudwyaz-zetcqymhsa-n
- molecular-weight:
- 188.226
