Difference between revisions of "CPD-7630"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7014 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5...") |
(Created page with "Category:metabolite == Metabolite CPD-7630 == * common-name: ** (-)-epicatechin * smiles: ** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o) * inchi-key: ** pftawblqpzve...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7630 == |
| + | * common-name: | ||
| + | ** (-)-epicatechin | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** pftawblqpzvemu-ukrrqhhqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 290.272 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9725]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(-)-epicatechin}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=pftawblqpzvemu-ukrrqhhqsa-n}} |
| + | {{#set: molecular-weight=290.272}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-7630
- common-name:
- (-)-epicatechin
- smiles:
- c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o)
- inchi-key:
- pftawblqpzvemu-ukrrqhhqsa-n
- molecular-weight:
- 290.272
