Difference between revisions of "CPD0-2340"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD0-2340 == * common-name: ** (z)-3-peroxyaminoacrylate * smiles: ** [ch](n)=cc(=o)oo * inchi-key: ** wqkgfglgyohjog-uphrsurjsa-n * mole...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2340 == |
* common-name: | * common-name: | ||
− | ** (- | + | ** (z)-3-peroxyaminoacrylate |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](n)=cc(=o)oo |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wqkgfglgyohjog-uphrsurjsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 103.077 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12894]] | ||
+ | * [[RXN0-6460]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=(- | + | {{#set: common-name=(z)-3-peroxyaminoacrylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqkgfglgyohjog-uphrsurjsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.077}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD0-2340
- common-name:
- (z)-3-peroxyaminoacrylate
- smiles:
- [ch](n)=cc(=o)oo
- inchi-key:
- wqkgfglgyohjog-uphrsurjsa-n
- molecular-weight:
- 103.077