Difference between revisions of "CPD-474"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-tRNAfmet == * common-name: ** an l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compound == * METHIONY...") |
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-474 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-taxifolin |
| + | * smiles: | ||
| + | ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) | ||
| + | * inchi-key: | ||
| + | ** cxqwrcvtcmqvqx-lsdhhaiusa-m | ||
| + | * molecular-weight: | ||
| + | ** 303.248 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-527]] |
| + | * [[RXN-600]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7775]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-taxifolin}} |
| + | {{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}} | ||
| + | {{#set: molecular-weight=303.248}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-474
- common-name:
- (+)-taxifolin
- smiles:
- c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
- inchi-key:
- cxqwrcvtcmqvqx-lsdhhaiusa-m
- molecular-weight:
- 303.248
