Difference between revisions of "Glycerophosphodiesters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17858 == * common-name: ** ω-saturated c55 dolichol phosphate * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite Glycerophosphodiesters == * common-name: ** a glycerophosphodiester == Reaction(s) known to consume the compound == * [[GLYCPDIESTER-RXN]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17858 ==
+
== Metabolite Glycerophosphodiesters ==
 
* common-name:
 
* common-name:
** ω-saturated c55 dolichol phosphate
+
** a glycerophosphodiester
* smiles:
 
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
 
* inchi-key:
 
** ktgsdhzxakcyhm-lstwdcehsa-l
 
* molecular-weight:
 
** 849.311
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16602]]
+
* [[GLYCPDIESTER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ω-saturated c55 dolichol phosphate}}
+
{{#set: common-name=a glycerophosphodiester}}
{{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}}
 
{{#set: molecular-weight=849.311}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Glycerophosphodiesters

  • common-name:
    • a glycerophosphodiester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality