Difference between revisions of "3Z-PHYTOCHROMOBILIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17319 == * common-name: ** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate * smiles: ** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cc...")
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17319 ==
+
== Metabolite 3Z-PHYTOCHROMOBILIN ==
 
* common-name:
 
* common-name:
** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate
+
** (3z)-phytochromobilin
 
* smiles:
 
* smiles:
** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cccccccc=ccccccccc)=o
+
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 
* inchi-key:
 
* inchi-key:
** hhmkvxgzzuomhm-xzrwtqcasa-l
+
** dkmlmzvdtgoegu-aikfxvfzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 700.975
+
** 582.655
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16077]]
+
* [[1.3.7.4-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate}}
+
{{#set: common-name=(3z)-phytochromobilin}}
{{#set: inchi-key=inchikey=hhmkvxgzzuomhm-xzrwtqcasa-l}}
+
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
{{#set: molecular-weight=700.975}}
+
{{#set: molecular-weight=582.655}}

Latest revision as of 11:14, 18 March 2021

Metabolite 3Z-PHYTOCHROMOBILIN

  • common-name:
    • (3z)-phytochromobilin
  • smiles:
    • cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
  • inchi-key:
    • dkmlmzvdtgoegu-aikfxvfzsa-l
  • molecular-weight:
    • 582.655

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality