Difference between revisions of "BENZOYLCOA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-N6-m-adenine1618 == * common-name: ** an n6-methyladenine1618 in 23s rrna == Reaction(s) known to consume the compound == == Rea...")
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-N6-m-adenine1618 ==
+
== Metabolite BENZOYLCOA ==
 
* common-name:
 
* common-name:
** an n6-methyladenine1618 in 23s rrna
+
** benzoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** vevjtunlalkrno-tyhxjlicsa-j
 +
* molecular-weight:
 +
** 867.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11596]]
+
* [[RXN-2006]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n6-methyladenine1618 in 23s rrna}}
+
{{#set: common-name=benzoyl-coa}}
 +
{{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}}
 +
{{#set: molecular-weight=867.61}}

Latest revision as of 11:14, 18 March 2021

Metabolite BENZOYLCOA

  • common-name:
    • benzoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • vevjtunlalkrno-tyhxjlicsa-j
  • molecular-weight:
    • 867.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality