Difference between revisions of "CPD-15431"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glc2Man9GlcNAc2-proteins == * common-name: ** glc2man9glcnac2-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-15431 == * common-name: ** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-un...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15431 == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc2(oc(co)c(o)c(o)c(nc(=o)c)2))nc(c)=o))c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** sgclprbyahbrpd-qozjjacasa-l | ||
+ | * molecular-weight: | ||
+ | ** 1331.648 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14561]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol}} |
+ | {{#set: inchi-key=inchikey=sgclprbyahbrpd-qozjjacasa-l}} | ||
+ | {{#set: molecular-weight=1331.648}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-15431
- common-name:
- n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc2(oc(co)c(o)c(o)c(nc(=o)c)2))nc(c)=o))c)c)c)c)c)c)c
- inchi-key:
- sgclprbyahbrpd-qozjjacasa-l
- molecular-weight:
- 1331.648