Difference between revisions of "CPD-12852"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
(Created page with "Category:metabolite == Metabolite CPD-12852 == * common-name: ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]3(ccc4(c)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13118 ==
+
== Metabolite CPD-12852 ==
 
* common-name:
 
* common-name:
** gdp-β-l-fucose
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
 
* smiles:
 
* smiles:
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
+
** cc(c)=cccc(c)[ch]3(ccc4(c)(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** lqebexmhblqmdb-jgqubwhwsa-l
+
** klzwthglldrkhd-pmiioqglsa-n
 
* molecular-weight:
 
* molecular-weight:
** 587.33
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.221-RXN]]
+
* [[RXN-11881]]
* [[2.4.1.68-RXN]]
+
* [[RXN21165]]
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-9463]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.271-RXN]]
+
* [[RXN-11876]]
* [[2.4.1.221-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-β-l-fucose}}
+
{{#set: common-name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
+
{{#set: inchi-key=inchikey=klzwthglldrkhd-pmiioqglsa-n}}
{{#set: molecular-weight=587.33}}
+
{{#set: molecular-weight=412.698}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-12852

  • common-name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
  • smiles:
    • cc(c)=cccc(c)[ch]3(ccc4(c)(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • klzwthglldrkhd-pmiioqglsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality