Difference between revisions of "Pre-tRNA-5-prime-half-molecules"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite Pre-tRNA-5-prime-half-molecules == * common-name: ** a 5'-half-trna molecule with a 2',3'-cyclic phosphate end == Reaction(s) known to co...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Pre-tRNA-5-prime-half-molecules == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5'-half-trna molecule with a 2',3'-cyclic phosphate end |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.27.9-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5'-half-trna molecule with a 2',3'-cyclic phosphate end}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Pre-tRNA-5-prime-half-molecules
- common-name:
- a 5'-half-trna molecule with a 2',3'-cyclic phosphate end
