Difference between revisions of "Triacylglycerides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * smiles: ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** mxhrcpnrjammim-shyze...") |
(Created page with "Category:metabolite == Metabolite Triacylglycerides == * common-name: ** a triglyceride == Reaction(s) known to consume the compound == * TRIACYLGLYCEROL-LIPASE-RXN ==...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Triacylglycerides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a triglyceride |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TRIACYLGLYCEROL-LIPASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a triglyceride}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Triacylglycerides
- common-name:
- a triglyceride
