Difference between revisions of "CPD-653"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Sterols == * common-name: ** a sterol == Reaction(s) known to consume the compound == * STEROL-GLUCOSYLTRANSFERASE-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-653 == * common-name: ** (s)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Sterols ==
+
== Metabolite CPD-653 ==
 
* common-name:
 
* common-name:
** a sterol
+
** (s)-nadhx
 +
* smiles:
 +
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
 +
* inchi-key:
 +
** idbzkgqrlbfufq-vphrtnkssa-l
 +
* molecular-weight:
 +
** 681.445
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
+
* [[4.2.1.93-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[STEROL-ESTERASE-RXN]]
+
* [[RXN-12752]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sterol}}
+
{{#set: common-name=(s)-nadhx}}
 +
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-vphrtnkssa-l}}
 +
{{#set: molecular-weight=681.445}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-653

  • common-name:
    • (s)-nadhx
  • smiles:
    • c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
  • inchi-key:
    • idbzkgqrlbfufq-vphrtnkssa-l
  • molecular-weight:
    • 681.445

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality