Difference between revisions of "CPD-653"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Sterols == * common-name: ** a sterol == Reaction(s) known to consume the compound == * STEROL-GLUCOSYLTRANSFERASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-653 == * common-name: ** (s)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-653 == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-nadhx |
+ | * smiles: | ||
+ | ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o) | ||
+ | * inchi-key: | ||
+ | ** idbzkgqrlbfufq-vphrtnkssa-l | ||
+ | * molecular-weight: | ||
+ | ** 681.445 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4.2.1.93-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12752]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-nadhx}} |
+ | {{#set: inchi-key=inchikey=idbzkgqrlbfufq-vphrtnkssa-l}} | ||
+ | {{#set: molecular-weight=681.445}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-653
- common-name:
- (s)-nadhx
- smiles:
- c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
- inchi-key:
- idbzkgqrlbfufq-vphrtnkssa-l
- molecular-weight:
- 681.445