Difference between revisions of "TRNA-guanosine18"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * m...") |
(Created page with "Category:metabolite == Metabolite tRNA-guanosine18 == * common-name: ** a guanosine18 in trna == Reaction(s) known to consume the compound == * 2.1.1.34-RXN == Reactio...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-guanosine18 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a guanosine18 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.1.1.34-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a guanosine18 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite tRNA-guanosine18
- common-name:
- a guanosine18 in trna
