Difference between revisions of "3-OXOPIMELOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMETHYL-GLYCINE == * common-name: ** n,n-dimethylglycine * smiles: ** c[n+](cc([o-])=o)c * inchi-key: ** ffdgpvchzbvarc-uhfffaoysa-n * m...")
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMETHYL-GLYCINE ==
+
== Metabolite 3-OXOPIMELOYL-COA ==
 
* common-name:
 
* common-name:
** n,n-dimethylglycine
+
** 3-oxopimeloyl-coa
 
* smiles:
 
* smiles:
** c[n+](cc([o-])=o)c
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ffdgpvchzbvarc-uhfffaoysa-n
+
** kjxfofktzdjlmq-uyrkptjqsa-i
 
* molecular-weight:
 
* molecular-weight:
** 103.121
+
** 918.632
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
+
* [[RXN-8032]]
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
* [[RXN-9680]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.5-RXN]]
+
* [[RXN-8032]]
* [[RXN-13404]]
 
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
* [[RXN-9679]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n,n-dimethylglycine}}
+
{{#set: common-name=3-oxopimeloyl-coa}}
{{#set: inchi-key=inchikey=ffdgpvchzbvarc-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}}
{{#set: molecular-weight=103.121}}
+
{{#set: molecular-weight=918.632}}

Latest revision as of 11:15, 18 March 2021

Metabolite 3-OXOPIMELOYL-COA

  • common-name:
    • 3-oxopimeloyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kjxfofktzdjlmq-uyrkptjqsa-i
  • molecular-weight:
    • 918.632

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality