Difference between revisions of "CPD-15189"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...") |
(Created page with "Category:metabolite == Metabolite CPD-15189 == * common-name: ** chenodeoxycholate * smiles: ** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](ccc(c)23)4))...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15189 == |
* common-name: | * common-name: | ||
| − | ** | + | ** chenodeoxycholate |
* smiles: | * smiles: | ||
| − | ** ccc= | + | ** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](ccc(c)23)4)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rudatbohqwojdd-bswaidmhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 391.57 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16033]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=chenodeoxycholate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rudatbohqwojdd-bswaidmhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=391.57}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-15189
- common-name:
- chenodeoxycholate
- smiles:
- cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](ccc(c)23)4))))
- inchi-key:
- rudatbohqwojdd-bswaidmhsa-m
- molecular-weight:
- 391.57
