Difference between revisions of "5-P-BETA-D-RIBOSYL-AMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * inc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DCTP ==
+
== Metabolite 5-P-BETA-D-RIBOSYL-AMINE ==
 
* common-name:
 
* common-name:
** dctp
+
** 5-phospho-β-d-ribosylamine
 
* smiles:
 
* smiles:
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
 
* inchi-key:
 
* inchi-key:
** rgwhqcvhvjxokc-shyzeuofsa-j
+
** skcbpevygoqgjn-txicztdvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 463.127
+
** 228.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DCTCP]]
+
* [[GLYRIBONUCSYN-RXN]]
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
* [[PRPPAMIDOTRANS-RXN]]
* [[DCTPtm]]
 
* [[DCTUP]]
 
* [[RXN-14198]]
 
* [[RXN-14216]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDCD]]
+
* [[PRPPAMIDOTRANS-RXN]]
* [[ATDCDm]]
 
* [[DCDPKIN-RXN]]
 
* [[DCTPtm]]
 
* [[RXN0-723]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dctp}}
+
{{#set: common-name=5-phospho-β-d-ribosylamine}}
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
+
{{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}}
{{#set: molecular-weight=463.127}}
+
{{#set: molecular-weight=228.118}}

Latest revision as of 11:15, 18 March 2021

Metabolite 5-P-BETA-D-RIBOSYL-AMINE

  • common-name:
    • 5-phospho-β-d-ribosylamine
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
  • inchi-key:
    • skcbpevygoqgjn-txicztdvsa-m
  • molecular-weight:
    • 228.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality