Difference between revisions of "CPD-12120"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite CPD-12120 == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12120 == |
* common-name: | * common-name: | ||
− | ** | + | ** demethylmenaquinol-11 |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c | ||
+ | * inchi-key: | ||
+ | ** wvrzwraihitkpi-sokmhqjssa-n | ||
+ | * molecular-weight: | ||
+ | ** 909.472 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9362]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-11}} |
+ | {{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}} | ||
+ | {{#set: molecular-weight=909.472}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12120
- common-name:
- demethylmenaquinol-11
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
- inchi-key:
- wvrzwraihitkpi-sokmhqjssa-n
- molecular-weight:
- 909.472