Difference between revisions of "CPD-10488"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOBUTANOL == * common-name: ** isobutanol * smiles: ** cc(c)co * inchi-key: ** zxekiibdnhejcq-uhfffaoysa-n * molecular-weight: ** 74.122...") |
(Created page with "Category:metabolite == Metabolite CPD-10488 == * common-name: ** n-formyl-d-kynurenine * smiles: ** c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1) * inchi-key: ** byhjhxptqmm...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10488 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-formyl-d-kynurenine |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** byhjhxptqmmkca-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 236.227 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8664]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-formyl-d-kynurenine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=byhjhxptqmmkca-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=236.227}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-10488
- common-name:
- n-formyl-d-kynurenine
- smiles:
- c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1)
- inchi-key:
- byhjhxptqmmkca-uhfffaoysa-n
- molecular-weight:
- 236.227
