Difference between revisions of "PYRIDOXINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXINE == * common-name: ** pyridoxine * smiles: ** cc1(=nc=c(c(=c1o)co)co) * inchi-key: ** lxnhxlltxmvwpm-uhfffaoysa-n * molecular-w...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PYRIDOXINE == |
* common-name: | * common-name: | ||
− | ** | + | ** pyridoxine |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=nc=c(c(=c1o)co)co) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lxnhxlltxmvwpm-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 169.18 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PNKIN-RXN]] |
− | * [[ | + | * [[PYRIDOXINE-4-DEHYDROGENASE-RXN]] |
− | * [[ | + | * [[PYRIDOXINE-4-OXIDASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PYRIDOXINE-4-DEHYDROGENASE-RXN]] | ||
+ | * [[RXN-14181]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pyridoxine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lxnhxlltxmvwpm-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=169.18}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PYRIDOXINE
- common-name:
- pyridoxine
- smiles:
- cc1(=nc=c(c(=c1o)co)co)
- inchi-key:
- lxnhxlltxmvwpm-uhfffaoysa-n
- molecular-weight:
- 169.18