Difference between revisions of "GLC"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BCAA-dehydrogenase-DH-lipoyl == * common-name: ** an [apo bcaa dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BCAA-dehydrogenase-DH-lipoyl ==
+
== Metabolite GLC ==
 
* common-name:
 
* common-name:
** an [apo bcaa dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine
+
** β-d-glucopyranose
 +
* smiles:
 +
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** wqzgkkkjijffok-vfuothlcsa-n
 +
* molecular-weight:
 +
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.168-RXN]]
+
* [[ALDOSE-1-EPIMERASE-RXN]]
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
* [[MBCOA-DHLIPOAMIDE-RXN]]
+
* [[biomass_rxn]]
* [[RXN-7719]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.168-RXN]]
+
* [[3.2.1.106-RXN]]
* [[MBCOA-DHLIPOAMIDE-RXN]]
+
* [[ALDOSE-1-EPIMERASE-RXN]]
* [[RXN-7719]]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 +
* [[TREHALA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [apo bcaa dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine}}
+
{{#set: common-name=β-d-glucopyranose}}
 +
{{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}}
 +
{{#set: molecular-weight=180.157}}

Latest revision as of 11:17, 18 March 2021

Metabolite GLC

  • common-name:
    • β-d-glucopyranose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-vfuothlcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality