Difference between revisions of "LEUKOTRIENE-C4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-358 == * common-name: ** (r)-lactaldehyde * smiles: ** cc([ch]=o)o * inchi-key: ** bsabbbmnwqwllu-gsvougtgsa-n * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-358 ==
+
== Metabolite LEUKOTRIENE-C4 ==
 
* common-name:
 
* common-name:
** (r)-lactaldehyde
+
** leukotriene-c4
 
* smiles:
 
* smiles:
** cc([ch]=o)o
+
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** bsabbbmnwqwllu-gsvougtgsa-n
+
** gwnvdxqdilpjig-nxolixfesa-l
 
* molecular-weight:
 
* molecular-weight:
** 74.079
+
** 623.76
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[RXN66-336]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-lactaldehyde}}
+
{{#set: common-name=leukotriene-c4}}
{{#set: inchi-key=inchikey=bsabbbmnwqwllu-gsvougtgsa-n}}
+
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
{{#set: molecular-weight=74.079}}
+
{{#set: molecular-weight=623.76}}

Latest revision as of 11:17, 18 March 2021

Metabolite LEUKOTRIENE-C4

  • common-name:
    • leukotriene-c4
  • smiles:
    • cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
  • inchi-key:
    • gwnvdxqdilpjig-nxolixfesa-l
  • molecular-weight:
    • 623.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality