Difference between revisions of "CPD6666-1"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8077 == * common-name: ** 1-18:1-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...")
(Created page with "Category:metabolite == Metabolite CPD6666-1 == * common-name: ** oleamide * smiles: ** ccccccccc=ccccccccc(n)=o * inchi-key: ** fatbgeamymyzaf-ktkrtigzsa-n * molecular-wei...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8077 ==
+
== Metabolite CPD6666-1 ==
 
* common-name:
 
* common-name:
** 1-18:1-2-16:2-monogalactosyldiacylglycerol
+
** oleamide
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
+
** ccccccccc=ccccccccc(n)=o
 
* inchi-key:
 
* inchi-key:
** sfkzppodzmclpe-nhgajdlwsa-n
+
** fatbgeamymyzaf-ktkrtigzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 753.067
+
** 281.481
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8303]]
+
* [[RXN-10756]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10756]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=oleamide}}
{{#set: inchi-key=inchikey=sfkzppodzmclpe-nhgajdlwsa-n}}
+
{{#set: inchi-key=inchikey=fatbgeamymyzaf-ktkrtigzsa-n}}
{{#set: molecular-weight=753.067}}
+
{{#set: molecular-weight=281.481}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD6666-1

  • common-name:
    • oleamide
  • smiles:
    • ccccccccc=ccccccccc(n)=o
  • inchi-key:
    • fatbgeamymyzaf-ktkrtigzsa-n
  • molecular-weight:
    • 281.481

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality