Difference between revisions of "DIPEPTIDES"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite K-HEXANOYL-COA == * common-name: ** 3-oxohexanoyl-coa * smiles: ** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite DIPEPTIDES == * common-name: ** a dipeptide == Reaction(s) known to consume the compound == * 3.4.13.18-RXN == Reaction(s) known to p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite K-HEXANOYL-COA ==
+
== Metabolite DIPEPTIDES ==
 
* common-name:
 
* common-name:
** 3-oxohexanoyl-coa
+
** a dipeptide
* smiles:
 
** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
 
* inchi-key:
 
** nfoyyxqavvywkv-hdrqghtbsa-j
 
* molecular-weight:
 
** 875.63
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HACD2h]]
+
* [[3.4.13.18-RXN]]
* [[RXN-12570]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT2h]]
+
* [[3.4.11.4-RXN]]
* [[HACD2h]]
+
* [[3.4.14.5-RXN]]
* [[RXN-12565]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxohexanoyl-coa}}
+
{{#set: common-name=a dipeptide}}
{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
 
{{#set: molecular-weight=875.63}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite DIPEPTIDES

  • common-name:
    • a dipeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality