Difference between revisions of "PYRIDOXAMINE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9459 == * common-name: ** oleanolate * smiles: ** cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c *...")
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE-5P == * common-name: ** pyridoxamine 5'-phosphate * smiles: ** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o) * inchi-key: ** z...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9459 ==
+
== Metabolite PYRIDOXAMINE-5P ==
 
* common-name:
 
* common-name:
** oleanolate
+
** pyridoxamine 5'-phosphate
 
* smiles:
 
* smiles:
** cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c([ch]1ccc(c2(ccc(cc3)4c([o-])=o)c)5c)(c)c)o)c))))c
+
** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
 
* inchi-key:
 
* inchi-key:
** mijyxulnpsfwek-gtofxwbisa-m
+
** zmjgsosnspkhnh-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 455.699
+
** 247.167
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9000]]
+
* [[PMPOXI-RXN]]
 +
* [[PYAMPP]]
 +
* [[RXN-14046]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PYRAMKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleanolate}}
+
{{#set: common-name=pyridoxamine 5'-phosphate}}
{{#set: inchi-key=inchikey=mijyxulnpsfwek-gtofxwbisa-m}}
+
{{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}}
{{#set: molecular-weight=455.699}}
+
{{#set: molecular-weight=247.167}}

Latest revision as of 11:17, 18 March 2021

Metabolite PYRIDOXAMINE-5P

  • common-name:
    • pyridoxamine 5'-phosphate
  • smiles:
    • cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
  • inchi-key:
    • zmjgsosnspkhnh-uhfffaoysa-m
  • molecular-weight:
    • 247.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality