Difference between revisions of "CPD-7061"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-cytochromes-c551 == * common-name: ** a reduced cytochrome c551 == Reaction(s) known to consume the compound == * RXN-15838 =...")
(Created page with "Category:metabolite == Metabolite CPD-7061 == * common-name: ** pheophorbide a * smiles: ** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=2...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-cytochromes-c551 ==
+
== Metabolite CPD-7061 ==
 
* common-name:
 
* common-name:
** a reduced cytochrome c551
+
** pheophorbide a
 +
* smiles:
 +
** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
 +
* inchi-key:
 +
** uxwyeazhzlzdgm-zvevzsnksa-m
 +
* molecular-weight:
 +
** 590.677
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15838]]
+
* [[RXN-17252]]
 +
* [[RXN-7740]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15838]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced cytochrome c551}}
+
{{#set: common-name=pheophorbide a}}
 +
{{#set: inchi-key=inchikey=uxwyeazhzlzdgm-zvevzsnksa-m}}
 +
{{#set: molecular-weight=590.677}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-7061

  • common-name:
    • pheophorbide a
  • smiles:
    • c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
  • inchi-key:
    • uxwyeazhzlzdgm-zvevzsnksa-m
  • molecular-weight:
    • 590.677

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality