Difference between revisions of "CPD-609"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * smiles: ** cc(=o)c(c)(o)c(=o)[o-] * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m *...")
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ACETO-LACTATE ==
+
== Metabolite CPD-609 ==
 
* common-name:
 
* common-name:
** (s)-2-acetolactate
+
** p1,p4-bis(5'-guanosyl) tetraphosphate
 
* smiles:
 
* smiles:
** cc(=o)c(c)(o)c(=o)[o-]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
 
* inchi-key:
 
* inchi-key:
** nmdwgegfjubklb-yfkpbyrvsa-m
+
** olgwxcqxrssqpo-mharetsrsa-j
 
* molecular-weight:
 
* molecular-weight:
** 131.108
+
** 864.359
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETOLACTREDUCTOISOM-RXN]]
+
* [[3.6.1.17-RXN]]
* [[RXN-14037]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETOLACTSYN-RXN]]
 
* [[RXN-14037]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2-acetolactate}}
+
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
{{#set: molecular-weight=131.108}}
+
{{#set: molecular-weight=864.359}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-609

  • common-name:
    • p1,p4-bis(5'-guanosyl) tetraphosphate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
  • inchi-key:
    • olgwxcqxrssqpo-mharetsrsa-j
  • molecular-weight:
    • 864.359

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality