Difference between revisions of "PWY-7112"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(o...")
 
(Created page with "Category:pathway == Pathway PWY-7112 == * taxonomic-range: ** tax-33154 * common-name: ** 4-hydroxy-2-nonenal detoxification == Reaction(s) found == * RXN-13673 * RX...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+
== Pathway PWY-7112 ==
 +
* taxonomic-range:
 +
** tax-33154
 
* common-name:
 
* common-name:
** unsaturated gellan tetrasaccharide
+
** 4-hydroxy-2-nonenal detoxification
* smiles:
+
== Reaction(s) found ==
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
+
* [[RXN-13673]]
* inchi-key:
+
* [[RXN-13675]]
** jmdplhpaglyhci-pqvubfrasa-m
+
* [[RXN-13677]]
* molecular-weight:
+
== Reaction(s) not found ==
** 645.544
+
* [NoneRXN-13678 RXN-13678]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33154}}
* [[RXN-12270]]
+
{{#set: common-name=4-hydroxy-2-nonenal detoxification}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=unsaturated gellan tetrasaccharide}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
 
{{#set: molecular-weight=645.544}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7112

  • taxonomic-range:
    • tax-33154
  • common-name:
    • 4-hydroxy-2-nonenal detoxification

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13678 RXN-13678]