Difference between revisions of "PWY-5915"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * common-name: ** carnosine * smiles: ** c(cc(=o)nc(cc1(=cnc=n1))c([o-]...")
 
(Created page with "Category:pathway == Pathway PWY-5915 == * taxonomic-range: ** tax-1117 * common-name: ** phycoerythrobilin biosynthesis i == Reaction(s) found == * 1.3.7.2-RXN * 1.3...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] ==
+
== Pathway PWY-5915 ==
 +
* taxonomic-range:
 +
** tax-1117
 
* common-name:
 
* common-name:
** carnosine
+
** phycoerythrobilin biosynthesis i
* smiles:
+
== Reaction(s) found ==
** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+]
+
* [[1.3.7.2-RXN]]
* inchi-key:
+
* [[1.3.7.3-RXN]]
** cqovpnpjlqnmdc-zetcqymhsa-n
+
* [[RXN-17523]]
* molecular-weight:
+
== Reaction(s) not found ==
** 226.235
+
* [NoneRXN-15985 RXN-15985]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-1117}}
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
+
{{#set: common-name=phycoerythrobilin biosynthesis i}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=carnosine}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=cqovpnpjlqnmdc-zetcqymhsa-n}}
 
{{#set: molecular-weight=226.235}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-5915

  • taxonomic-range:
    • tax-1117
  • common-name:
    • phycoerythrobilin biosynthesis i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-15985 RXN-15985]