Difference between revisions of "MELIBIOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite epoxides == * common-name: ** an epoxide == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite MELIBIOSE == * common-name: ** melibiose * smiles: ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o * inchi-key: ** dlrvvldznnycbx-zzfzym...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MELIBIOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** melibiose |
+ | * smiles: | ||
+ | ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o | ||
+ | * inchi-key: | ||
+ | ** dlrvvldznnycbx-zzfzymbesa-n | ||
+ | * molecular-weight: | ||
+ | ** 342.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ALPHAGALACTOSID-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=melibiose}} |
+ | {{#set: inchi-key=inchikey=dlrvvldznnycbx-zzfzymbesa-n}} | ||
+ | {{#set: molecular-weight=342.299}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MELIBIOSE
- common-name:
- melibiose
- smiles:
- c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o
- inchi-key:
- dlrvvldznnycbx-zzfzymbesa-n
- molecular-weight:
- 342.299