Difference between revisions of "Demethylated-Ubiquinols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite Demethylated-Ubiquinols == * common-name: ** a demethylated ubiquinol == Reaction(s) known to consume the compound == * RXN-11758 ==...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Demethylated-Ubiquinols == |
* common-name: | * common-name: | ||
− | ** | + | ** a demethylated ubiquinol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11758]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a demethylated ubiquinol}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Demethylated-Ubiquinols
- common-name:
- a demethylated ubiquinol