Difference between revisions of "DEOXYCYTIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...") |
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYCYTIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxycytidine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cktsbutuhbmzgz-shyzeuofsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 227.219 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CYTIDEAM-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxycytidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=227.219}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DEOXYCYTIDINE
- common-name:
- 2'-deoxycytidine
- smiles:
- c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
- inchi-key:
- cktsbutuhbmzgz-shyzeuofsa-n
- molecular-weight:
- 227.219
