Difference between revisions of "MAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...") |
(Created page with "Category:metabolite == Metabolite MAL == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: ** bjepykjpyrnkow-reohclbhsa-l * molecular-weight...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MAL == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-malate |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(=o)([o-])cc(o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bjepykjpyrnkow-reohclbhsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 132.073 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.1.39-RXN]] |
| − | * [[ | + | * [[FUMHYDR-RXN]] |
| − | * [[ | + | * [[MALATE-DEH-RXN]] |
| − | * [[ | + | * [[MALIC-NADP-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FUMHYDR-RXN]] |
| − | * [[ | + | * [[MALATE-DEH-RXN]] |
| − | * [[ | + | * [[MALATE-DEHYDROGENASE-NADP+-RXN]] |
| − | * [[ | + | * [[MALSYN-RXN]] |
| − | * [[ | + | * [[RXN-14937]] |
| + | * [[RXN-6002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-malate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bjepykjpyrnkow-reohclbhsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=132.073}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MAL
- common-name:
- (s)-malate
- smiles:
- c(=o)([o-])cc(o)c([o-])=o
- inchi-key:
- bjepykjpyrnkow-reohclbhsa-l
- molecular-weight:
- 132.073
