Difference between revisions of "N-terminal-L-alanine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTACONYL-COA == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite N-terminal-L-alanine == * common-name: ** an n-terminal l-alanyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUTACONYL-COA ==
+
== Metabolite N-terminal-L-alanine ==
 
* common-name:
 
* common-name:
** (e)-glutaconyl-coa
+
** an n-terminal l-alanyl-[protein]
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** urtlotisfjppou-degqqwijsa-i
 
* molecular-weight:
 
** 874.579
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
+
* [[RXN-17873]]
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-glutaconyl-coa}}
+
{{#set: common-name=an n-terminal l-alanyl-[protein]}}
{{#set: inchi-key=inchikey=urtlotisfjppou-degqqwijsa-i}}
 
{{#set: molecular-weight=874.579}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite N-terminal-L-alanine

  • common-name:
    • an n-terminal l-alanyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.