Difference between revisions of "GLYCOLALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11855 == * common-name: ** (r)-4-hydroxy-4-methyl-2-oxoglutarate * smiles: ** cc(o)(cc(c(=o)[o-])=o)c([o-])=o * inchi-key: ** yrwamsx...") |
(Created page with "Category:metabolite == Metabolite GLYCOLALDEHYDE == * common-name: ** glycolaldehyde * smiles: ** c(o)[ch]=o * inchi-key: ** wgcnasohlspbmp-uhfffaoysa-n * molecular-weight...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLYCOLALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** glycolaldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wgcnasohlspbmp-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 60.052 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14023]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[H2NEOPTERINALDOL-RXN]] |
+ | * [[RXN-10857]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glycolaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wgcnasohlspbmp-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=60.052}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite GLYCOLALDEHYDE
- common-name:
- glycolaldehyde
- smiles:
- c(o)[ch]=o
- inchi-key:
- wgcnasohlspbmp-uhfffaoysa-n
- molecular-weight:
- 60.052