Difference between revisions of "P-NITROPHENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-208 == * common-name: ** (s)-malyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...") |
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite P-NITROPHENOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-nitrophenol |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** btjiuguipkrlhp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 138.102 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] | ||
| + | * [[ARYLDIALKYL-PHOSPHATASE-RXN]] | ||
| + | * [[RXN-17830]] | ||
| + | * [[RXN-8743]] | ||
| + | * [[RXN-8746]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-nitrophenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=138.102}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite P-NITROPHENOL
- common-name:
- 4-nitrophenol
- smiles:
- c1(c=c([o-])c=cc=1[n+](=o)[o-])
- inchi-key:
- btjiuguipkrlhp-uhfffaoysa-m
- molecular-weight:
- 138.102
