Difference between revisions of "CPD-4573"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key: ** dscffeyyqksrsv-geskjzqwsa-...") |
(Created page with "Category:metabolite == Metabolite CPD-4573 == * common-name: ** 14-oxolanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(c=o)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c))))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4573 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 14-oxolanosterol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc([ch]1(c2(c)(c(c=o)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pggimliqohyfis-puxrvuthsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 440.708 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-305]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-304]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=14-oxolanosterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pggimliqohyfis-puxrvuthsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=440.708}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-4573
- common-name:
- 14-oxolanosterol
- smiles:
- cc(c)=cccc([ch]1(c2(c)(c(c=o)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
- inchi-key:
- pggimliqohyfis-puxrvuthsa-n
- molecular-weight:
- 440.708
