Difference between revisions of "CPD-8050"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...") |
(Created page with "Category:metabolite == Metabolite CPD-8050 == * common-name: ** scyllo-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-cdrysyessa-n * molecul...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8050 == |
* common-name: | * common-name: | ||
− | ** | + | ** scyllo-inositol |
* smiles: | * smiles: | ||
− | ** | + | ** c1(c(c(c(c(c1o)o)o)o)o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cdaismweouebre-cdrysyessa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13779]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13779]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=scyllo-inositol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cdaismweouebre-cdrysyessa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-8050
- common-name:
- scyllo-inositol
- smiles:
- c1(c(c(c(c(c1o)o)o)o)o)o
- inchi-key:
- cdaismweouebre-cdrysyessa-n
- molecular-weight:
- 180.157