Difference between revisions of "Myo-inositol-polyphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15654 == * common-name: ** 2-trans, 4-cis-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
(Created page with "Category:metabolite == Metabolite Myo-inositol-polyphosphates == * common-name: ** a myo-inositol-polyphosphate == Reaction(s) known to consume the compound == * 3.6.1.5...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15654 ==
+
== Metabolite Myo-inositol-polyphosphates ==
 
* common-name:
 
* common-name:
** 2-trans, 4-cis-undecadienoyl-coa
+
** a myo-inositol-polyphosphate
* smiles:
 
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** szkpluulggerfd-nfpsboapsa-j
 
* molecular-weight:
 
** 927.749
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14776]]
+
* [[3.6.1.52-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14775]]
+
* [[3.6.1.52-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 4-cis-undecadienoyl-coa}}
+
{{#set: common-name=a myo-inositol-polyphosphate}}
{{#set: inchi-key=inchikey=szkpluulggerfd-nfpsboapsa-j}}
 
{{#set: molecular-weight=927.749}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Myo-inositol-polyphosphates

  • common-name:
    • a myo-inositol-polyphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality