Difference between revisions of "1-3-alpha-D-Glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19489 == * common-name: ** 3-isopropyl-8-(methylthio)-2-oxooctanoate * smiles: ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** y...") |
(Created page with "Category:metabolite == Metabolite 1-3-alpha-D-Glucans == * common-name: ** a 1,3-α-d-glucan == Reaction(s) known to consume the compound == * 3.2.1.84-RXN == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-3-alpha-D-Glucans == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** a 1,3-α-d-glucan |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.2.1.84-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[3.2.1.84-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=a 1,3-α-d-glucan}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 1-3-alpha-D-Glucans
- common-name:
- a 1,3-α-d-glucan