Difference between revisions of "Gamma-linolenoyl-groups"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...") |
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Gamma-linolenoyl-groups == |
* common-name: | * common-name: | ||
− | ** | + | ** a [glycerolipid]-γ-linolenate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11681]] |
+ | * [[RXN-16040]] | ||
+ | * [[RXN-16043]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11680]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-γ-linolenate}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Gamma-linolenoyl-groups
- common-name:
- a [glycerolipid]-γ-linolenate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.