Difference between revisions of "CPD-7279"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRATE == * common-name: ** 4-aminobutanoate * smiles: ** c(c[n+])cc([o-])=o * inchi-key: ** btcsszjgundroe-uhfffaoysa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7279 == |
* common-name: | * common-name: | ||
− | ** 4- | + | ** 2-cis,4-trans-xanthoxin |
* smiles: | * smiles: | ||
− | ** c(c | + | ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ztalkmxohwqnia-tvbshjcbsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 250.337 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.1.1.288-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-698]] |
− | + | * [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]] | |
− | * [[RXN- | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4- | + | {{#set: common-name=2-cis,4-trans-xanthoxin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=250.337}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7279
- common-name:
- 2-cis,4-trans-xanthoxin
- smiles:
- cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
- inchi-key:
- ztalkmxohwqnia-tvbshjcbsa-n
- molecular-weight:
- 250.337