Difference between revisions of "CPD-23709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...") |
(Created page with "Category:metabolite == Metabolite CPD-23709 == * common-name: ** 31-norcycloartenone * inchi-key: ** dnrvhchszdhkim-xjxrdsncsa-n * molecular-weight: ** 410.682 * smiles: *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-23709 == |
* common-name: | * common-name: | ||
− | ** | + | ** 31-norcycloartenone |
− | |||
− | |||
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dnrvhchszdhkim-xjxrdsncsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 410.682 |
+ | * smiles: | ||
+ | ** cc(c)=ccc[c@@h](c)[c@h]3(cc[c@@]4(c)([c@@h]1(cc[c@h]5([c@h](c)c(=o)cc[c@@]2(c[c@@]12cc[c@](c)34)5)))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-21831]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-21830]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=31-norcycloartenone}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dnrvhchszdhkim-xjxrdsncsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=410.682}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-23709
- common-name:
- 31-norcycloartenone
- inchi-key:
- dnrvhchszdhkim-xjxrdsncsa-n
- molecular-weight:
- 410.682
- smiles:
- cc(c)=ccc[c@@h](c)[c@h]3(cc[c@@]4(c)([c@@h]1(cc[c@h]5([c@h](c)c(=o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))