Difference between revisions of "CPD-23709"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...")
(Created page with "Category:metabolite == Metabolite CPD-23709 == * common-name: ** 31-norcycloartenone * inchi-key: ** dnrvhchszdhkim-xjxrdsncsa-n * molecular-weight: ** 410.682 * smiles: *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLC-D-LACTONE ==
+
== Metabolite CPD-23709 ==
 
* common-name:
 
* common-name:
** d-glucono-1,5-lactone
+
** 31-norcycloartenone
* smiles:
 
** c(o)c1(oc(c(c(c1o)o)o)=o)
 
 
* inchi-key:
 
* inchi-key:
** phoqvhqstubqqk-sqougzdysa-n
+
** dnrvhchszdhkim-xjxrdsncsa-n
 
* molecular-weight:
 
* molecular-weight:
** 178.141
+
** 410.682
 +
* smiles:
 +
** cc(c)=ccc[c@@h](c)[c@h]3(cc[c@@]4(c)([c@@h]1(cc[c@h]5([c@h](c)c(=o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOLACT-RXN]]
+
* [[RXN-21831]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-21830]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucono-1,5-lactone}}
+
{{#set: common-name=31-norcycloartenone}}
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
+
{{#set: inchi-key=inchikey=dnrvhchszdhkim-xjxrdsncsa-n}}
{{#set: molecular-weight=178.141}}
+
{{#set: molecular-weight=410.682}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-23709

  • common-name:
    • 31-norcycloartenone
  • inchi-key:
    • dnrvhchszdhkim-xjxrdsncsa-n
  • molecular-weight:
    • 410.682
  • smiles:
    • cc(c)=ccc[c@@h](c)[c@h]3(cc[c@@]4(c)([c@@h]1(cc[c@h]5([c@h](c)c(=o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality