Difference between revisions of "UROCANATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20012 == * common-name: ** naringenin chalcone * smiles: ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) * inchi-key: ** yqhmwtpy...") |
(Created page with "Category:metabolite == Metabolite UROCANATE == * common-name: ** urocanate * smiles: ** c1(nc=nc=1c=cc([o-])=o) * inchi-key: ** loiymiarkyctbw-owojbtedsa-m * molecular-wei...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UROCANATE == |
* common-name: | * common-name: | ||
− | ** | + | ** urocanate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(nc=nc=1c=cc([o-])=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** loiymiarkyctbw-owojbtedsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 137.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HISTIDINE-AMMONIA-LYASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=urocanate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=loiymiarkyctbw-owojbtedsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.118}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite UROCANATE
- common-name:
- urocanate
- smiles:
- c1(nc=nc=1c=cc([o-])=o)
- inchi-key:
- loiymiarkyctbw-owojbtedsa-m
- molecular-weight:
- 137.118