Difference between revisions of "NOREPINEPHRINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ASCORBATE == * common-name: ** l-ascorbate * smiles: ** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1) * inchi-key: ** ciwbshskhkdkbq-jlaznsocsa-m *...") |
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NOREPINEPHRINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-noradrenaline |
* smiles: | * smiles: | ||
| − | ** c(o)c( | + | ** c1(c=c(o)c(=cc=1c(c[n+])o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sflshlfxelfnjz-qmmmgpobsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 170.188 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10907]] | ||
| + | == Reaction(s) known to produce the compound == | ||
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-noradrenaline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.188}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite NOREPINEPHRINE
- common-name:
- (r)-noradrenaline
- smiles:
- c1(c=c(o)c(=cc=1c(c[n+])o)o)
- inchi-key:
- sflshlfxelfnjz-qmmmgpobsa-o
- molecular-weight:
- 170.188
